C14H28N4O2 — CID 61211937
2-amino-N-[2-[[1-(dimethylamino)-3-methylcyclohexyl]methylamino]-2-oxoethyl]acetamide (PubChem CID 61211937) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-amino-N-[2-[[1-(dimethylamino)-3-methylcyclohexyl]methylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[[1-(dimethylamino)-3-methylcyclohexyl]methylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 61211937 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 2-amino-N-[2-[[1-(dimethylamino)-3-methylcyclohexyl]methylamino]-2-oxoethyl]acetamide |
| SMILES | CC1CCCC(CNC(=O)CNC(=O)CN)(N(C)C)C1 |
| InChI | InChI=1S/C14H28N4O2/c1-11-5-4-6-14(7-11,18(2)3)10-17-13(20)9-16-12(19)8-15/h11H,4-10,15H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | NAHWFDNBSARNGV-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |