C17H28N2O2 — CID 61212854
4-[[[1-(dimethylamino)-3-methylcyclohexyl]methylamino]methyl]benzene-1,2-diol (PubChem CID 61212854) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 4-[[[1-(dimethylamino)-3-methylcyclohexyl]methylamino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[[1-(dimethylamino)-3-methylcyclohexyl]methylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 61212854 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 4-[[[1-(dimethylamino)-3-methylcyclohexyl]methylamino]methyl]benzene-1,2-diol |
| SMILES | CC1CCCC(CNCc2ccc(O)c(O)c2)(N(C)C)C1 |
| InChI | InChI=1S/C17H28N2O2/c1-13-5-4-8-17(10-13,19(2)3)12-18-11-14-6-7-15(20)16(21)9-14/h6-7,9,13,18,20-21H,4-5,8,10-12H2,1-3H3 |
| InChIKey | PUIIHVANVGRRMM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|