C25H29NO8 — CID 6121453
(4E)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6121453) has the molecular formula C25H29NO8 and a molecular weight of 471.51 g/mol. Its IUPAC name is (4E)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6121453 |
| Molecular Formula | C25H29NO8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (4E)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-(2-methoxyethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc(/C(O)=C2\C(=O)C(=O)N(CCOC)C2c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C25H29NO8/c1-6-34-17-9-7-8-15(12-17)22(27)20-21(26(10-11-30-2)25(29)23(20)28)16-13-18(31-3)24(33-5)19(14-16)32-4/h7-9,12-14,21,27H,6,10-11H2,1-5H3/b22-20+ |
| InChIKey | XKLULUYMXAGPII-LSDHQDQOSA-N |
| XLogP | 3.18 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|