C32H23ClN4O5S — CID 6121515
(5'Z)-5'-[[2-[(2-chlorophenyl)methoxy]-5-nitrophenyl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 6121515) has the molecular formula C32H23ClN4O5S and a molecular weight of 611.08 g/mol. Its IUPAC name is (5'Z)-5'-[[2-[(2-chlorophenyl)methoxy]-5-nitrophenyl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | (5'Z)-5'-[[2-[(2-chlorophenyl)methoxy]-5-nitrophenyl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 6121515 |
| Molecular Formula | C32H23ClN4O5S |
| Molecular Weight | 611.08 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | (5'Z)-5'-[[2-[(2-chlorophenyl)methoxy]-5-nitrophenyl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | O=C1NC2(Oc3ccccc3C3CC(c4ccccc4)=NN32)/C(=C/c2cc([N+](=O)[O-])ccc2OCc2ccccc2Cl)S1 |
| InChI | InChI=1S/C32H23ClN4O5S/c33-25-12-6-4-10-21(25)19-41-28-15-14-23(37(39)40)16-22(28)17-30-32(34-31(38)43-30)36-27(24-11-5-7-13-29(24)42-32)18-26(35-36)20-8-2-1-3-9-20/h1-17,27H,18-19H2,(H,34,38)/b30-17- |
| InChIKey | OOSRETDKXSKQSQ-LQNQUEJISA-N |
| XLogP | 7.52 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.08 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|