About 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate
2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate (PubChem CID 61215415) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate |
| PubChem CID | 61215415 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate |
| SMILES | CC(C)COC(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C7H12N4O2/c1-5(2)3-13-7(12)10-6-8-4-9-11-6/h4-5H,3H2,1-2H3,(H2,8,9,10,11,12) |
| InChIKey | BHDNLJBRDQISED-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate?
The IUPAC name of 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate (CID 61215415) is 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate.
What is the SMILES notation for 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate?
The canonical SMILES for 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate is CC(C)COC(=O)Nc1ncn[nH]1.
What is the InChIKey of 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate?
The InChIKey is BHDNLJBRDQISED-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c1-5(2)3-13-7(12)10-6-8-4-9-11-6/h4-5H,3H2,1-2H3,(H2,8,9,10,11,12).
What are the key properties of 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate?
2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate has a molecular weight of 184.20 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-(1H-1,2,4-triazol-5-yl)carbamate is sourced from PubChem (CID 61215415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).