C20H40N2O4 — CID 612163
N,N'-diheptyl-2,3-dihydroxy-N,N'-dimethylbutanediamide (PubChem CID 612163) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is N,N'-diheptyl-2,3-dihydroxy-N,N'-dimethylbutanediamide.
| Compound Name | N,N'-diheptyl-2,3-dihydroxy-N,N'-dimethylbutanediamide |
|---|---|
| PubChem CID | 612163 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | N,N'-diheptyl-2,3-dihydroxy-N,N'-dimethylbutanediamide |
| SMILES | CCCCCCCN(C)C(=O)C(O)C(O)C(=O)N(C)CCCCCCC |
| InChI | InChI=1S/C20H40N2O4/c1-5-7-9-11-13-15-21(3)19(25)17(23)18(24)20(26)22(4)16-14-12-10-8-6-2/h17-18,23-24H,5-16H2,1-4H3 |
| InChIKey | BOEJXKCNKIMDCG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|