C14H22BNO — CID 612175
2-butyl-3,4-dimethyl-5-phenyl-1,3,2-oxazaborolidine (PubChem CID 612175) has the molecular formula C14H22BNO and a molecular weight of 231.15 g/mol. Its IUPAC name is 2-butyl-3,4-dimethyl-5-phenyl-1,3,2-oxazaborolidine.
| Compound Name | 2-butyl-3,4-dimethyl-5-phenyl-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 612175 |
| Molecular Formula | C14H22BNO |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 2-butyl-3,4-dimethyl-5-phenyl-1,3,2-oxazaborolidine |
| SMILES | CCCCB1OC(c2ccccc2)C(C)N1C |
| InChI | InChI=1S/C14H22BNO/c1-4-5-11-15-16(3)12(2)14(17-15)13-9-7-6-8-10-13/h6-10,12,14H,4-5,11H2,1-3H3 |
| InChIKey | FTBXGQMOYJBKCA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|