About 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one
3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one (PubChem CID 61218363) has the molecular formula C13H13N3OS2
and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one |
| PubChem CID | 61218363 |
| Molecular Formula | C13H13N3OS2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one |
| SMILES | CCNC1C(=O)Nc2cc(Sc3nccs3)ccc21 |
| InChI | InChI=1S/C13H13N3OS2/c1-2-14-11-9-4-3-8(7-10(9)16-12(11)17)19-13-15-5-6-18-13/h3-7,11,14H,2H2,1H3,(H,16,17) |
| InChIKey | PPBISOVZQIHVSB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one?
The IUPAC name of 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one (CID 61218363) is 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one?
The canonical SMILES for 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one is CCNC1C(=O)Nc2cc(Sc3nccs3)ccc21.
What is the InChIKey of 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one?
The InChIKey is PPBISOVZQIHVSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3OS2/c1-2-14-11-9-4-3-8(7-10(9)16-12(11)17)19-13-15-5-6-18-13/h3-7,11,14H,2H2,1H3,(H,16,17).
What are the key properties of 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one?
3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one has a molecular weight of 291.40 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)-6-(1,3-thiazol-2-ylsulfanyl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 61218363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).