About 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile
4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile (PubChem CID 61218934) has the molecular formula C12H8N2OS2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile |
| PubChem CID | 61218934 |
| Molecular Formula | C12H8N2OS2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)CSc2nccs2)cc1 |
| InChI | InChI=1S/C12H8N2OS2/c13-7-9-1-3-10(4-2-9)11(15)8-17-12-14-5-6-16-12/h1-6H,8H2 |
| InChIKey | BBNDAIKYPOESJK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile?
The IUPAC name of 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile (CID 61218934) is 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile.
What is the SMILES notation for 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile?
The canonical SMILES for 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile is N#Cc1ccc(C(=O)CSc2nccs2)cc1.
What is the InChIKey of 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile?
The InChIKey is BBNDAIKYPOESJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2OS2/c13-7-9-1-3-10(4-2-9)11(15)8-17-12-14-5-6-16-12/h1-6H,8H2.
What are the key properties of 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile?
4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile has a molecular weight of 260.34 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-thiazol-2-ylsulfanyl)acetyl]benzonitrile is sourced from PubChem (CID 61218934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).