About 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid
4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid (PubChem CID 61219341) has the molecular formula C13H17NO5S
and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid.
Molecular Properties
| Compound Name | 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid |
| PubChem CID | 61219341 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)N1CCOc2ccccc2C1 |
| InChI | InChI=1S/C13H17NO5S/c15-13(16)6-3-9-20(17,18)14-7-8-19-12-5-2-1-4-11(12)10-14/h1-2,4-5H,3,6-10H2,(H,15,16) |
| InChIKey | KDJMVPNXTKTNDF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid?
The IUPAC name of 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid (CID 61219341) is 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid.
What is the SMILES notation for 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid?
The canonical SMILES for 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid is O=C(O)CCCS(=O)(=O)N1CCOc2ccccc2C1.
What is the InChIKey of 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid?
The InChIKey is KDJMVPNXTKTNDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5S/c15-13(16)6-3-9-20(17,18)14-7-8-19-12-5-2-1-4-11(12)10-14/h1-2,4-5H,3,6-10H2,(H,15,16).
What are the key properties of 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid?
4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid has a molecular weight of 299.35 g/mol, XLogP of 1.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylsulfonyl)butanoic acid is sourced from PubChem (CID 61219341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).