C18H11Cl2FN2O2 — CID 612195
N-(2,4-dichlorophenyl)-2-(4-fluorophenoxy)pyridine-3-carboxamide (PubChem CID 612195) has the molecular formula C18H11Cl2FN2O2 and a molecular weight of 377.20 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(4-fluorophenoxy)pyridine-3-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(4-fluorophenoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 612195 |
| Molecular Formula | C18H11Cl2FN2O2 |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(4-fluorophenoxy)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1cccnc1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C18H11Cl2FN2O2/c19-11-3-8-16(15(20)10-11)23-17(24)14-2-1-9-22-18(14)25-13-6-4-12(21)5-7-13/h1-10H,(H,23,24) |
| InChIKey | VMJPXSAAJLMMHS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |