About 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid
2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid (PubChem CID 61219501) has the molecular formula C13H8N2O2S2
and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid |
| PubChem CID | 61219501 |
| Molecular Formula | C13H8N2O2S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Sc2nccs2)nc2ccccc12 |
| InChI | InChI=1S/C13H8N2O2S2/c16-12(17)9-7-11(19-13-14-5-6-18-13)15-10-4-2-1-3-8(9)10/h1-7H,(H,16,17) |
| InChIKey | CQURLJUINJDCTN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid?
The IUPAC name of 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid (CID 61219501) is 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid.
What is the SMILES notation for 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid?
The canonical SMILES for 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid is O=C(O)c1cc(Sc2nccs2)nc2ccccc12.
What is the InChIKey of 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid?
The InChIKey is CQURLJUINJDCTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O2S2/c16-12(17)9-7-11(19-13-14-5-6-18-13)15-10-4-2-1-3-8(9)10/h1-7H,(H,16,17).
What are the key properties of 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid?
2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid has a molecular weight of 288.35 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-ylsulfanyl)quinoline-4-carboxylic acid is sourced from PubChem (CID 61219501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).