About 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol
2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol (PubChem CID 61219884) has the molecular formula C10H10N2OS2
and a molecular weight of 238.34 g/mol. Its IUPAC name is 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol.
Molecular Properties
| Compound Name | 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol |
| PubChem CID | 61219884 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol |
| SMILES | Nc1cc(CSc2nccs2)ccc1O |
| InChI | InChI=1S/C10H10N2OS2/c11-8-5-7(1-2-9(8)13)6-15-10-12-3-4-14-10/h1-5,13H,6,11H2 |
| InChIKey | TXLNWNQKKRYRNI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol?
The IUPAC name of 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol (CID 61219884) is 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol.
What is the SMILES notation for 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol?
The canonical SMILES for 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol is Nc1cc(CSc2nccs2)ccc1O.
What is the InChIKey of 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol?
The InChIKey is TXLNWNQKKRYRNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS2/c11-8-5-7(1-2-9(8)13)6-15-10-12-3-4-14-10/h1-5,13H,6,11H2.
What are the key properties of 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol?
2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol has a molecular weight of 238.34 g/mol, XLogP of 2.72, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(1,3-thiazol-2-ylsulfanylmethyl)phenol is sourced from PubChem (CID 61219884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).