About 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile
3-(1,3-thiazol-2-ylsulfanyl)butanenitrile (PubChem CID 61220077) has the molecular formula C7H8N2S2
and a molecular weight of 184.29 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile.
Molecular Properties
| Compound Name | 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile |
| PubChem CID | 61220077 |
| Molecular Formula | C7H8N2S2 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile |
| SMILES | CC(CC#N)Sc1nccs1 |
| InChI | InChI=1S/C7H8N2S2/c1-6(2-3-8)11-7-9-4-5-10-7/h4-6H,2H2,1H3 |
| InChIKey | AGSZYIYUUHBYIV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile?
The IUPAC name of 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile (CID 61220077) is 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile.
What is the SMILES notation for 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile?
The canonical SMILES for 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile is CC(CC#N)Sc1nccs1.
What is the InChIKey of 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile?
The InChIKey is AGSZYIYUUHBYIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2S2/c1-6(2-3-8)11-7-9-4-5-10-7/h4-6H,2H2,1H3.
What are the key properties of 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile?
3-(1,3-thiazol-2-ylsulfanyl)butanenitrile has a molecular weight of 184.29 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-thiazol-2-ylsulfanyl)butanenitrile is sourced from PubChem (CID 61220077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).