C17H19NO2 — CID 61222500
N-[4-(2-hydroxyethyl)phenyl]-2,3-dimethylbenzamide (PubChem CID 61222500) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is N-[4-(2-hydroxyethyl)phenyl]-2,3-dimethylbenzamide.
| Compound Name | N-[4-(2-hydroxyethyl)phenyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 61222500 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-[4-(2-hydroxyethyl)phenyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(CCO)cc2)c1C |
| InChI | InChI=1S/C17H19NO2/c1-12-4-3-5-16(13(12)2)17(20)18-15-8-6-14(7-9-15)10-11-19/h3-9,19H,10-11H2,1-2H3,(H,18,20) |
| InChIKey | LQXZNGZXXROAED-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |