C29H24FN3O5S2 — CID 6122320
(4E)-5-(3-ethoxyphenyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 6122320) has the molecular formula C29H24FN3O5S2 and a molecular weight of 577.66 g/mol. Its IUPAC name is (4E)-5-(3-ethoxyphenyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-ethoxyphenyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6122320 |
| Molecular Formula | C29H24FN3O5S2 |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | (4E)-5-(3-ethoxyphenyl)-1-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc(C2/C(=C(\O)c3ccc(OC)cc3)C(=O)C(=O)N2c2nnc(SCc3ccc(F)cc3)s2)c1 |
| InChI | InChI=1S/C29H24FN3O5S2/c1-3-38-22-6-4-5-19(15-22)24-23(25(34)18-9-13-21(37-2)14-10-18)26(35)27(36)33(24)28-31-32-29(40-28)39-16-17-7-11-20(30)12-8-17/h4-15,24,34H,3,16H2,1-2H3/b25-23+ |
| InChIKey | LRHAZSJPYVNLSE-WJTDDFOZSA-N |
| XLogP | 6.00 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|