C14H14N2O2 — CID 61223962
N-[4-(2-hydroxyethyl)phenyl]pyridine-2-carboxamide (PubChem CID 61223962) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is N-[4-(2-hydroxyethyl)phenyl]pyridine-2-carboxamide.
| Compound Name | N-[4-(2-hydroxyethyl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 61223962 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-[4-(2-hydroxyethyl)phenyl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(CCO)cc1)c1ccccn1 |
| InChI | InChI=1S/C14H14N2O2/c17-10-8-11-4-6-12(7-5-11)16-14(18)13-3-1-2-9-15-13/h1-7,9,17H,8,10H2,(H,16,18) |
| InChIKey | WBVVQRXHONEZLH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |