C16H24 — CID 612248
1,2,3,3a,4,5,5a,6,7,8,8a,9,10,10a-tetradecahydropyrene (PubChem CID 612248) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 1,2,3,3a,4,5,5a,6,7,8,8a,9,10,10a-tetradecahydropyrene.
| Compound Name | 1,2,3,3a,4,5,5a,6,7,8,8a,9,10,10a-tetradecahydropyrene |
|---|---|
| PubChem CID | 612248 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 1,2,3,3a,4,5,5a,6,7,8,8a,9,10,10a-tetradecahydropyrene |
| SMILES | C1CC2CCC3CCCC4CCC(C1)C2=C34 |
| InChI | InChI=1S/C16H24/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h11-14H,1-10H2 |
| InChIKey | GHRTVTPXHFXING-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|