About 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one
3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one (PubChem CID 61225327) has the molecular formula C10H10ClN3OS
and a molecular weight of 255.73 g/mol. Its IUPAC name is 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one |
| PubChem CID | 61225327 |
| Molecular Formula | C10H10ClN3OS |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(Cc2nc(CCl)cs2)cn1 |
| InChI | InChI=1S/C10H10ClN3OS/c1-7-2-10(15)14(6-12-7)4-9-13-8(3-11)5-16-9/h2,5-6H,3-4H2,1H3 |
| InChIKey | IKOJBFHQSRQHPA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one?
The IUPAC name of 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one (CID 61225327) is 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one.
What is the SMILES notation for 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one?
The canonical SMILES for 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one is Cc1cc(=O)n(Cc2nc(CCl)cs2)cn1.
What is the InChIKey of 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one?
The InChIKey is IKOJBFHQSRQHPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3OS/c1-7-2-10(15)14(6-12-7)4-9-13-8(3-11)5-16-9/h2,5-6H,3-4H2,1H3.
What are the key properties of 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one?
3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one has a molecular weight of 255.73 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-6-methylpyrimidin-4-one is sourced from PubChem (CID 61225327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).