C15H18N4O — CID 61225923
7-amino-6-(3,4,5-trimethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 61225923) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 7-amino-6-(3,4,5-trimethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-amino-6-(3,4,5-trimethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 61225923 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 7-amino-6-(3,4,5-trimethylpyrazol-1-yl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1nn(-c2cc3c(cc2N)NC(=O)CC3)c(C)c1C |
| InChI | InChI=1S/C15H18N4O/c1-8-9(2)18-19(10(8)3)14-6-11-4-5-15(20)17-13(11)7-12(14)16/h6-7H,4-5,16H2,1-3H3,(H,17,20) |
| InChIKey | MVUNWWLYCDBBFM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|