About 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid
5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid (PubChem CID 61226525) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid.
Molecular Properties
| Compound Name | 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid |
| PubChem CID | 61226525 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid |
| SMILES | Cc1nn(CCCCC(=O)O)c(C)c1C |
| InChI | InChI=1S/C11H18N2O2/c1-8-9(2)12-13(10(8)3)7-5-4-6-11(14)15/h4-7H2,1-3H3,(H,14,15) |
| InChIKey | AZYCDNONMPPZPQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid?
The IUPAC name of 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid (CID 61226525) is 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid.
What is the SMILES notation for 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid?
The canonical SMILES for 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid is Cc1nn(CCCCC(=O)O)c(C)c1C.
What is the InChIKey of 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid?
The InChIKey is AZYCDNONMPPZPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-8-9(2)12-13(10(8)3)7-5-4-6-11(14)15/h4-7H2,1-3H3,(H,14,15).
What are the key properties of 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid?
5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid has a molecular weight of 210.28 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4,5-trimethylpyrazol-1-yl)pentanoic acid is sourced from PubChem (CID 61226525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).