About 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole
1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole (PubChem CID 61226930) has the molecular formula C12H17ClN4
and a molecular weight of 252.75 g/mol. Its IUPAC name is 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole.
Molecular Properties
| Compound Name | 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole |
| PubChem CID | 61226930 |
| Molecular Formula | C12H17ClN4 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole |
| SMILES | Cc1nn(Cc2c(C)nn(C)c2Cl)c(C)c1C |
| InChI | InChI=1S/C12H17ClN4/c1-7-8(2)15-17(10(7)4)6-11-9(3)14-16(5)12(11)13/h6H2,1-5H3 |
| InChIKey | MSIAYSXQTHWDHF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole?
The IUPAC name of 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole (CID 61226930) is 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole.
What is the SMILES notation for 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole?
The canonical SMILES for 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole is Cc1nn(Cc2c(C)nn(C)c2Cl)c(C)c1C.
What is the InChIKey of 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole?
The InChIKey is MSIAYSXQTHWDHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN4/c1-7-8(2)15-17(10(7)4)6-11-9(3)14-16(5)12(11)13/h6H2,1-5H3.
What are the key properties of 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole?
1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole has a molecular weight of 252.75 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-3,4,5-trimethylpyrazole is sourced from PubChem (CID 61226930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).