C19H24N2 — CID 61226976
2-(3-methylpyrrolidin-1-yl)-1,2-diphenylethanamine (PubChem CID 61226976) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-(3-methylpyrrolidin-1-yl)-1,2-diphenylethanamine.
| Compound Name | 2-(3-methylpyrrolidin-1-yl)-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 61226976 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2-(3-methylpyrrolidin-1-yl)-1,2-diphenylethanamine |
| SMILES | CC1CCN(C(c2ccccc2)C(N)c2ccccc2)C1 |
| InChI | InChI=1S/C19H24N2/c1-15-12-13-21(14-15)19(17-10-6-3-7-11-17)18(20)16-8-4-2-5-9-16/h2-11,15,18-19H,12-14,20H2,1H3 |
| InChIKey | UIKCGLSTYVEEIJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |