About 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine
5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine (PubChem CID 61227510) has the molecular formula C10H14BrN3O2S
and a molecular weight of 320.21 g/mol. Its IUPAC name is 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine |
| PubChem CID | 61227510 |
| Molecular Formula | C10H14BrN3O2S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine |
| SMILES | Nc1cc(Br)cnc1NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H14BrN3O2S/c11-7-5-9(12)10(13-6-7)14-8-1-3-17(15,16)4-2-8/h5-6,8H,1-4,12H2,(H,13,14) |
| InChIKey | LVJNBFGYPYKEJI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine?
The IUPAC name of 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine (CID 61227510) is 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine.
What is the SMILES notation for 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine?
The canonical SMILES for 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine is Nc1cc(Br)cnc1NC1CCS(=O)(=O)CC1.
What is the InChIKey of 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine?
The InChIKey is LVJNBFGYPYKEJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN3O2S/c11-7-5-9(12)10(13-6-7)14-8-1-3-17(15,16)4-2-8/h5-6,8H,1-4,12H2,(H,13,14).
What are the key properties of 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine?
5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine has a molecular weight of 320.21 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-N-(1,1-dioxothian-4-yl)pyridine-2,3-diamine is sourced from PubChem (CID 61227510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).