C11H16BrN3 — CID 61228674
5-bromo-2-N-cyclopentyl-2-N-methylpyridine-2,3-diamine (PubChem CID 61228674) has the molecular formula C11H16BrN3 and a molecular weight of 270.17 g/mol. Its IUPAC name is 5-bromo-2-N-cyclopentyl-2-N-methylpyridine-2,3-diamine.
| Compound Name | 5-bromo-2-N-cyclopentyl-2-N-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 61228674 |
| Molecular Formula | C11H16BrN3 |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 5-bromo-2-N-cyclopentyl-2-N-methylpyridine-2,3-diamine |
| SMILES | CN(c1ncc(Br)cc1N)C1CCCC1 |
| InChI | InChI=1S/C11H16BrN3/c1-15(9-4-2-3-5-9)11-10(13)6-8(12)7-14-11/h6-7,9H,2-5,13H2,1H3 |
| InChIKey | UWGWGYGRNZOSBG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |