C10H11F4NO2S — CID 61230337
4-fluoro-N-(2-methylsulfonylethyl)-3-(trifluoromethyl)aniline (PubChem CID 61230337) has the molecular formula C10H11F4NO2S and a molecular weight of 285.26 g/mol. Its IUPAC name is 4-fluoro-N-(2-methylsulfonylethyl)-3-(trifluoromethyl)aniline.
| Compound Name | 4-fluoro-N-(2-methylsulfonylethyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 61230337 |
| Molecular Formula | C10H11F4NO2S |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-fluoro-N-(2-methylsulfonylethyl)-3-(trifluoromethyl)aniline |
| SMILES | CS(=O)(=O)CCNc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11F4NO2S/c1-18(16,17)5-4-15-7-2-3-9(11)8(6-7)10(12,13)14/h2-3,6,15H,4-5H2,1H3 |
| InChIKey | HCABUKCQYLLMHZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |