C18H27ClN2 — CID 61231118
N-[1-(3-chlorophenyl)ethyl]-N-propyl-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 61231118) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-N-propyl-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-N-propyl-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 61231118 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-N-propyl-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CCCN(C1CC2CCC(C1)N2)C(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H27ClN2/c1-3-9-21(13(2)14-5-4-6-15(19)10-14)18-11-16-7-8-17(12-18)20-16/h4-6,10,13,16-18,20H,3,7-9,11-12H2,1-2H3 |
| InChIKey | WHRFRIHCGLQHED-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |