About 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide
2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide (PubChem CID 61233601) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide.
Molecular Properties
| Compound Name | 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide |
| PubChem CID | 61233601 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide |
| SMILES | CCCCC(CC)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C12H25NO3/c1-3-5-6-11(4-2)12(16)13(7-9-14)8-10-15/h11,14-15H,3-10H2,1-2H3 |
| InChIKey | GFESPMJIFMIPOU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide?
The IUPAC name of 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide (CID 61233601) is 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide.
What is the SMILES notation for 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide?
The canonical SMILES for 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide is CCCCC(CC)C(=O)N(CCO)CCO.
What is the InChIKey of 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide?
The InChIKey is GFESPMJIFMIPOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-3-5-6-11(4-2)12(16)13(7-9-14)8-10-15/h11,14-15H,3-10H2,1-2H3.
What are the key properties of 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide?
2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide has a molecular weight of 231.34 g/mol, XLogP of 1.02, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,N-bis(2-hydroxyethyl)hexanamide is sourced from PubChem (CID 61233601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).