About 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide
2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide (PubChem CID 61234329) has the molecular formula C10H21NO3S
and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide |
| PubChem CID | 61234329 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide |
| SMILES | CC(C)(C)SCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C10H21NO3S/c1-10(2,3)15-8-9(14)11(4-6-12)5-7-13/h12-13H,4-8H2,1-3H3 |
| InChIKey | MJELXSLTCWUZBQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide?
The IUPAC name of 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide (CID 61234329) is 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide.
What is the SMILES notation for 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide?
The canonical SMILES for 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide is CC(C)(C)SCC(=O)N(CCO)CCO.
What is the InChIKey of 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide?
The InChIKey is MJELXSLTCWUZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3S/c1-10(2,3)15-8-9(14)11(4-6-12)5-7-13/h12-13H,4-8H2,1-3H3.
What are the key properties of 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide?
2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide has a molecular weight of 235.35 g/mol, XLogP of 0.33, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylsulfanyl-N,N-bis(2-hydroxyethyl)acetamide is sourced from PubChem (CID 61234329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).