C9H16N4 — CID 61234752
N'-(6-ethylpyrimidin-4-yl)propane-1,3-diamine (PubChem CID 61234752) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N'-(6-ethylpyrimidin-4-yl)propane-1,3-diamine.
| Compound Name | N'-(6-ethylpyrimidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 61234752 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N'-(6-ethylpyrimidin-4-yl)propane-1,3-diamine |
| SMILES | CCc1cc(NCCCN)ncn1 |
| InChI | InChI=1S/C9H16N4/c1-2-8-6-9(13-7-12-8)11-5-3-4-10/h6-7H,2-5,10H2,1H3,(H,11,12,13) |
| InChIKey | GZLUGUQNXVRBQJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|