About 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide
3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide (PubChem CID 61234870) has the molecular formula C7H15N3O4
and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide.
Molecular Properties
| Compound Name | 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide |
| PubChem CID | 61234870 |
| Molecular Formula | C7H15N3O4 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide |
| SMILES | NC(CC(=O)N(CCO)CCO)=NO |
| InChI | InChI=1S/C7H15N3O4/c8-6(9-14)5-7(13)10(1-3-11)2-4-12/h11-12,14H,1-5H2,(H2,8,9) |
| InChIKey | ZULNJDVKTPUEMV-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide?
The IUPAC name of 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide (CID 61234870) is 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide.
What is the SMILES notation for 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide?
The canonical SMILES for 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide is NC(CC(=O)N(CCO)CCO)=NO.
What is the InChIKey of 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide?
The InChIKey is ZULNJDVKTPUEMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O4/c8-6(9-14)5-7(13)10(1-3-11)2-4-12/h11-12,14H,1-5H2,(H2,8,9).
What are the key properties of 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide?
3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide has a molecular weight of 205.21 g/mol, XLogP of -2.06, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-bis(2-hydroxyethyl)-3-hydroxyiminopropanamide is sourced from PubChem (CID 61234870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).