About 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide
2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide (PubChem CID 61235232) has the molecular formula C6H15N3O3
and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide |
| PubChem CID | 61235232 |
| Molecular Formula | C6H15N3O3 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide |
| SMILES | NC(CN(CCO)CCO)=NO |
| InChI | InChI=1S/C6H15N3O3/c7-6(8-12)5-9(1-3-10)2-4-11/h10-12H,1-5H2,(H2,7,8) |
| InChIKey | RQAATTBUOVILMK-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide (CID 61235232) is 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide is NC(CN(CCO)CCO)=NO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide?
The InChIKey is RQAATTBUOVILMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3O3/c7-6(8-12)5-9(1-3-10)2-4-11/h10-12H,1-5H2,(H2,7,8).
What are the key properties of 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide?
2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide has a molecular weight of 177.20 g/mol, XLogP of -1.98, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide is sourced from PubChem (CID 61235232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).