C11H16N2O4 — CID 61235629
5-amino-2-[bis(2-hydroxyethyl)amino]benzoic acid (PubChem CID 61235629) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5-amino-2-[bis(2-hydroxyethyl)amino]benzoic acid.
| Compound Name | 5-amino-2-[bis(2-hydroxyethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61235629 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 5-amino-2-[bis(2-hydroxyethyl)amino]benzoic acid |
| SMILES | Nc1ccc(N(CCO)CCO)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H16N2O4/c12-8-1-2-10(9(7-8)11(16)17)13(3-5-14)4-6-15/h1-2,7,14-15H,3-6,12H2,(H,16,17) |
| InChIKey | RASDVUOVPVOSLB-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|