C14H26N4O2 — CID 61236323
2-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)-N-(tert-butylcarbamoyl)acetamide (PubChem CID 61236323) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)-N-(tert-butylcarbamoyl)acetamide.
| Compound Name | 2-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)-N-(tert-butylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 61236323 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2-(3-amino-8-azabicyclo[3.2.1]octan-8-yl)-N-(tert-butylcarbamoyl)acetamide |
| SMILES | CC(C)(C)NC(=O)NC(=O)CN1C2CCC1CC(N)C2 |
| InChI | InChI=1S/C14H26N4O2/c1-14(2,3)17-13(20)16-12(19)8-18-10-4-5-11(18)7-9(15)6-10/h9-11H,4-8,15H2,1-3H3,(H2,16,17,19,20) |
| InChIKey | UXROOEIDTMINLG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |