C14H14N4O2S — CID 61236656
3-[6-(3,4,5-trimethylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid (PubChem CID 61236656) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-[6-(3,4,5-trimethylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[6-(3,4,5-trimethylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 61236656 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-[6-(3,4,5-trimethylpyrazol-1-yl)imidazo[2,1-b][1,3]thiazol-5-yl]prop-2-enoic acid |
| SMILES | Cc1nn(-c2nc3sccn3c2C=CC(=O)O)c(C)c1C |
| InChI | InChI=1S/C14H14N4O2S/c1-8-9(2)16-18(10(8)3)13-11(4-5-12(19)20)17-6-7-21-14(17)15-13/h4-7H,1-3H3,(H,19,20) |
| InChIKey | SSDMATDVOGZIIA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|