About [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine
[6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine (PubChem CID 61237579) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine |
| PubChem CID | 61237579 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine |
| SMILES | CCc1c(C)nn(-c2ccc(CN)cn2)c1C |
| InChI | InChI=1S/C13H18N4/c1-4-12-9(2)16-17(10(12)3)13-6-5-11(7-14)8-15-13/h5-6,8H,4,7,14H2,1-3H3 |
| InChIKey | CZIHSNPYMKNWPE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine?
The IUPAC name of [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine (CID 61237579) is [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine.
What is the SMILES notation for [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine?
The canonical SMILES for [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine is CCc1c(C)nn(-c2ccc(CN)cn2)c1C.
What is the InChIKey of [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine?
The InChIKey is CZIHSNPYMKNWPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4/c1-4-12-9(2)16-17(10(12)3)13-6-5-11(7-14)8-15-13/h5-6,8H,4,7,14H2,1-3H3.
What are the key properties of [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine?
[6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine has a molecular weight of 230.31 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methanamine is sourced from PubChem (CID 61237579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).