C20H20N3O+ — CID 6123792
1,5-dimethyl-2-phenyl-4-[[(E)-3-phenylprop-2-enylidene]amino]-4H-pyrazol-1-ium-3-one (PubChem CID 6123792) has the molecular formula C20H20N3O+ and a molecular weight of 318.40 g/mol. Its IUPAC name is 1,5-dimethyl-2-phenyl-4-[[(E)-3-phenylprop-2-enylidene]amino]-4H-pyrazol-1-ium-3-one.
| Compound Name | 1,5-dimethyl-2-phenyl-4-[[(E)-3-phenylprop-2-enylidene]amino]-4H-pyrazol-1-ium-3-one |
|---|---|
| PubChem CID | 6123792 |
| Molecular Formula | C20H20N3O+ |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1,5-dimethyl-2-phenyl-4-[[(E)-3-phenylprop-2-enylidene]amino]-4H-pyrazol-1-ium-3-one |
| SMILES | CC1=[N+](C)N(c2ccccc2)C(=O)C1/N=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H20N3O/c1-16-19(21-15-9-12-17-10-5-3-6-11-17)20(24)23(22(16)2)18-13-7-4-8-14-18/h3-15,19H,1-2H3/q+1/b12-9+,21-15+ |
| InChIKey | LBVNOSVATJAEII-VUPRMNMUSA-N |
| XLogP | 3.20 |
| TPSA | 35.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|