About 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol
4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol (PubChem CID 61239072) has the molecular formula C17H18FNOS
and a molecular weight of 303.40 g/mol. Its IUPAC name is 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol.
Molecular Properties
| Compound Name | 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol |
| PubChem CID | 61239072 |
| Molecular Formula | C17H18FNOS |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNC2CCSc3c(F)cccc32)cc1 |
| InChI | InChI=1S/C17H18FNOS/c18-15-3-1-2-14-16(9-11-21-17(14)15)19-10-8-12-4-6-13(20)7-5-12/h1-7,16,19-20H,8-11H2 |
| InChIKey | LMRJCISZHBGXFX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol?
The IUPAC name of 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol (CID 61239072) is 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol.
What is the SMILES notation for 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol?
The canonical SMILES for 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol is Oc1ccc(CCNC2CCSc3c(F)cccc32)cc1.
What is the InChIKey of 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol?
The InChIKey is LMRJCISZHBGXFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FNOS/c18-15-3-1-2-14-16(9-11-21-17(14)15)19-10-8-12-4-6-13(20)7-5-12/h1-7,16,19-20H,8-11H2.
What are the key properties of 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol?
4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol has a molecular weight of 303.40 g/mol, XLogP of 3.90, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethyl]phenol is sourced from PubChem (CID 61239072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).