C23H50O8Si4 — CID 612395
trimethylsilyl 6-(3-methylbutanoyloxy)-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate (PubChem CID 612395) has the molecular formula C23H50O8Si4 and a molecular weight of 566.99 g/mol. Its IUPAC name is trimethylsilyl 6-(3-methylbutanoyloxy)-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate.
| Compound Name | trimethylsilyl 6-(3-methylbutanoyloxy)-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 612395 |
| Molecular Formula | C23H50O8Si4 |
| Molecular Weight | 566.99 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | trimethylsilyl 6-(3-methylbutanoyloxy)-3,4,5-tris(trimethylsilyloxy)oxane-2-carboxylate |
| SMILES | CC(C)CC(=O)OC1OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C23H50O8Si4/c1-16(2)15-17(24)26-23-21(30-34(9,10)11)19(29-33(6,7)8)18(28-32(3,4)5)20(27-23)22(25)31-35(12,13)14/h16,18-21,23H,15H2,1-14H3 |
| InChIKey | UZPBHXXATBUUKR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.99 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|