C19H19N3OS — CID 612420
6-amino-N-(2,3-dimethylphenyl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide (PubChem CID 612420) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 6-amino-N-(2,3-dimethylphenyl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide.
| Compound Name | 6-amino-N-(2,3-dimethylphenyl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 612420 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 6-amino-N-(2,3-dimethylphenyl)-4-thia-2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8-tetraene-5-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2sc3nc4c(cc3c2N)CCC4)c1C |
| InChI | InChI=1S/C19H19N3OS/c1-10-5-3-7-14(11(10)2)21-18(23)17-16(20)13-9-12-6-4-8-15(12)22-19(13)24-17/h3,5,7,9H,4,6,8,20H2,1-2H3,(H,21,23) |
| InChIKey | FGFIVSXFFWDIPQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |