About 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol
4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol (PubChem CID 61247005) has the molecular formula C13H25F3N2O
and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol.
Molecular Properties
| Compound Name | 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol |
| PubChem CID | 61247005 |
| Molecular Formula | C13H25F3N2O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol |
| SMILES | CC(C)CC(CO)NC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H25F3N2O/c1-10(2)7-12(8-19)17-11-3-5-18(6-4-11)9-13(14,15)16/h10-12,17,19H,3-9H2,1-2H3 |
| InChIKey | ZYNLAJGMQQJOJK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol?
The IUPAC name of 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol (CID 61247005) is 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol.
What is the SMILES notation for 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol?
The canonical SMILES for 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol is CC(C)CC(CO)NC1CCN(CC(F)(F)F)CC1.
What is the InChIKey of 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol?
The InChIKey is ZYNLAJGMQQJOJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25F3N2O/c1-10(2)7-12(8-19)17-11-3-5-18(6-4-11)9-13(14,15)16/h10-12,17,19H,3-9H2,1-2H3.
What are the key properties of 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol?
4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol has a molecular weight of 282.35 g/mol, XLogP of 2.01, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pentan-1-ol is sourced from PubChem (CID 61247005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).