C14H23N3O4 — CID 61247357
N-(1-hydroxy-4-methylpentan-2-yl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide (PubChem CID 61247357) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylpentan-2-yl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-(1-hydroxy-4-methylpentan-2-yl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 61247357 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(1-hydroxy-4-methylpentan-2-yl)-1-(2-methoxyethyl)-6-oxopyridazine-3-carboxamide |
| SMILES | COCCn1nc(C(=O)NC(CO)CC(C)C)ccc1=O |
| InChI | InChI=1S/C14H23N3O4/c1-10(2)8-11(9-18)15-14(20)12-4-5-13(19)17(16-12)6-7-21-3/h4-5,10-11,18H,6-9H2,1-3H3,(H,15,20) |
| InChIKey | UEJLBRFWGPDMNE-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |