About N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide (PubChem CID 61248073) has the molecular formula C11H9N3O3
and a molecular weight of 231.21 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide.
Molecular Properties
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide |
| PubChem CID | 61248073 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C11H9N3O3/c1-2-8(15)12-7-5-3-4-6-9(7)11(17)14-13-10(6)16/h2-5H,1H2,(H,12,15)(H,13,16)(H,14,17) |
| InChIKey | PJWKHQKFDDXTEA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide?
The IUPAC name of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide (CID 61248073) is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide.
What is the SMILES notation for N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide?
The canonical SMILES for N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide is C=CC(=O)Nc1cccc2c(=O)[nH][nH]c(=O)c12.
What is the InChIKey of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide?
The InChIKey is PJWKHQKFDDXTEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O3/c1-2-8(15)12-7-5-3-4-6-9(7)11(17)14-13-10(6)16/h2-5H,1H2,(H,12,15)(H,13,16)(H,14,17).
What are the key properties of N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide?
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide has a molecular weight of 231.21 g/mol, XLogP of 0.34, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)prop-2-enamide is sourced from PubChem (CID 61248073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).