C15H20FNO2 — CID 61249393
N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-3-oxobutanamide (PubChem CID 61249393) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-3-oxobutanamide.
| Compound Name | N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 61249393 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2,2-dimethylpropyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NC(c1ccc(F)cc1)C(C)(C)C |
| InChI | InChI=1S/C15H20FNO2/c1-10(18)9-13(19)17-14(15(2,3)4)11-5-7-12(16)8-6-11/h5-8,14H,9H2,1-4H3,(H,17,19) |
| InChIKey | MUSUMSCFEUPHQO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|