About 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid
4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid (PubChem CID 61249811) has the molecular formula C8H11ClN2O4S2
and a molecular weight of 298.77 g/mol. Its IUPAC name is 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid.
Molecular Properties
| Compound Name | 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid |
| PubChem CID | 61249811 |
| Molecular Formula | C8H11ClN2O4S2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)NCCCC(=O)O |
| InChI | InChI=1S/C8H11ClN2O4S2/c1-5-7(16-8(9)11-5)17(14,15)10-4-2-3-6(12)13/h10H,2-4H2,1H3,(H,12,13) |
| InChIKey | FPZXWTXCULRCCM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid?
The IUPAC name of 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid (CID 61249811) is 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid.
What is the SMILES notation for 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid?
The canonical SMILES for 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid is Cc1nc(Cl)sc1S(=O)(=O)NCCCC(=O)O.
What is the InChIKey of 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid?
The InChIKey is FPZXWTXCULRCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2O4S2/c1-5-7(16-8(9)11-5)17(14,15)10-4-2-3-6(12)13/h10H,2-4H2,1H3,(H,12,13).
What are the key properties of 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid?
4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid has a molecular weight of 298.77 g/mol, XLogP of 1.25, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]butanoic acid is sourced from PubChem (CID 61249811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).