C25H17BrN4O4S — CID 6125057
(5'Z)-9-bromo-5'-[(3-nitrophenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 6125057) has the molecular formula C25H17BrN4O4S and a molecular weight of 549.41 g/mol. Its IUPAC name is (5'Z)-9-bromo-5'-[(3-nitrophenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | (5'Z)-9-bromo-5'-[(3-nitrophenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 6125057 |
| Molecular Formula | C25H17BrN4O4S |
| Molecular Weight | 549.41 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | (5'Z)-9-bromo-5'-[(3-nitrophenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | O=C1NC2(Oc3ccc(Br)cc3C3CC(c4ccccc4)=NN32)/C(=C/c2cccc([N+](=O)[O-])c2)S1 |
| InChI | InChI=1S/C25H17BrN4O4S/c26-17-9-10-22-19(13-17)21-14-20(16-6-2-1-3-7-16)28-29(21)25(34-22)23(35-24(31)27-25)12-15-5-4-8-18(11-15)30(32)33/h1-13,21H,14H2,(H,27,31)/b23-12- |
| InChIKey | RCAFAKOWHZHLQX-FMCGGJTJSA-N |
| XLogP | 6.05 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|