About N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide
N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (PubChem CID 61251787) has the molecular formula C10H20F3N3O2S
and a molecular weight of 303.35 g/mol. Its IUPAC name is N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| PubChem CID | 61251787 |
| Molecular Formula | C10H20F3N3O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| SMILES | CCCCN(CC(F)(F)F)S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H20F3N3O2S/c1-2-3-6-16(9-10(11,12)13)19(17,18)15-7-4-14-5-8-15/h14H,2-9H2,1H3 |
| InChIKey | HXTLLQVIEXSYJJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The IUPAC name of N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (CID 61251787) is N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
What is the SMILES notation for N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The canonical SMILES for N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide is CCCCN(CC(F)(F)F)S(=O)(=O)N1CCNCC1.
What is the InChIKey of N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
The InChIKey is HXTLLQVIEXSYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3N3O2S/c1-2-3-6-16(9-10(11,12)13)19(17,18)15-7-4-14-5-8-15/h14H,2-9H2,1H3.
What are the key properties of N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide?
N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide has a molecular weight of 303.35 g/mol, XLogP of 0.80, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide is sourced from PubChem (CID 61251787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).