C13H19N3O3S — CID 61252197
N-(2,3-dihydro-1-benzofuran-2-ylmethyl)piperazine-1-sulfonamide (PubChem CID 61252197) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-2-ylmethyl)piperazine-1-sulfonamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-2-ylmethyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61252197 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-2-ylmethyl)piperazine-1-sulfonamide |
| SMILES | O=S(=O)(NCC1Cc2ccccc2O1)N1CCNCC1 |
| InChI | InChI=1S/C13H19N3O3S/c17-20(18,16-7-5-14-6-8-16)15-10-12-9-11-3-1-2-4-13(11)19-12/h1-4,12,14-15H,5-10H2 |
| InChIKey | UPIJCGMGMDUKGR-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |