About N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide
N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide (PubChem CID 61253124) has the molecular formula C12H27N3O2S
and a molecular weight of 277.43 g/mol. Its IUPAC name is N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide |
| PubChem CID | 61253124 |
| Molecular Formula | C12H27N3O2S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide |
| SMILES | CC(C)(C)CC(C)(C)NS(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C12H27N3O2S/c1-11(2,3)10-12(4,5)14-18(16,17)15-8-6-13-7-9-15/h13-14H,6-10H2,1-5H3 |
| InChIKey | KCJRXZISXMKYKC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide?
The IUPAC name of N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide (CID 61253124) is N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide.
What is the SMILES notation for N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide?
The canonical SMILES for N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide is CC(C)(C)CC(C)(C)NS(=O)(=O)N1CCNCC1.
What is the InChIKey of N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide?
The InChIKey is KCJRXZISXMKYKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3O2S/c1-11(2,3)10-12(4,5)14-18(16,17)15-8-6-13-7-9-15/h13-14H,6-10H2,1-5H3.
What are the key properties of N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide?
N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide has a molecular weight of 277.43 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4,4-trimethylpentan-2-yl)piperazine-1-sulfonamide is sourced from PubChem (CID 61253124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).