About N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide
N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide (PubChem CID 61253337) has the molecular formula C9H15N5O3S
and a molecular weight of 273.32 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide |
| PubChem CID | 61253337 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide |
| SMILES | O=S(=O)(Nc1nnc(C2CC2)o1)N1CCNCC1 |
| InChI | InChI=1S/C9H15N5O3S/c15-18(16,14-5-3-10-4-6-14)13-9-12-11-8(17-9)7-1-2-7/h7,10H,1-6H2,(H,12,13) |
| InChIKey | CGYQORNDDKGLLZ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide?
The IUPAC name of N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide (CID 61253337) is N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide.
What is the SMILES notation for N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide?
The canonical SMILES for N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide is O=S(=O)(Nc1nnc(C2CC2)o1)N1CCNCC1.
What is the InChIKey of N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide?
The InChIKey is CGYQORNDDKGLLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O3S/c15-18(16,14-5-3-10-4-6-14)13-9-12-11-8(17-9)7-1-2-7/h7,10H,1-6H2,(H,12,13).
What are the key properties of N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide?
N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide has a molecular weight of 273.32 g/mol, XLogP of -0.49, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)piperazine-1-sulfonamide is sourced from PubChem (CID 61253337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).